C18H28N2O3 — CID 122517572
[2-(diethylcarbamoyl)phenyl] N,N-dipropylcarbamate (PubChem CID 122517572) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is [2-(diethylcarbamoyl)phenyl] N,N-dipropylcarbamate.
| Compound Name | [2-(diethylcarbamoyl)phenyl] N,N-dipropylcarbamate |
|---|---|
| PubChem CID | 122517572 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | [2-(diethylcarbamoyl)phenyl] N,N-dipropylcarbamate |
| SMILES | CCCN(CCC)C(=O)Oc1ccccc1C(=O)N(CC)CC |
| InChI | InChI=1S/C18H28N2O3/c1-5-13-20(14-6-2)18(22)23-16-12-10-9-11-15(16)17(21)19(7-3)8-4/h9-12H,5-8,13-14H2,1-4H3 |
| InChIKey | FDBAQTCKUXYZIG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |