C20H32N2O3 — CID 122517612
[4-tert-butyl-2-(diethylcarbamoyl)phenyl] N,N-diethylcarbamate (PubChem CID 122517612) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is [4-tert-butyl-2-(diethylcarbamoyl)phenyl] N,N-diethylcarbamate.
| Compound Name | [4-tert-butyl-2-(diethylcarbamoyl)phenyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 122517612 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | [4-tert-butyl-2-(diethylcarbamoyl)phenyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc(C(C)(C)C)cc1C(=O)N(CC)CC |
| InChI | InChI=1S/C20H32N2O3/c1-8-21(9-2)18(23)16-14-15(20(5,6)7)12-13-17(16)25-19(24)22(10-3)11-4/h12-14H,8-11H2,1-7H3 |
| InChIKey | DBQISOKNPVIEFU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |