C15H22IN3O3 — CID 134943200
[4-(diethylcarbamoyl)-2-iodo-3-pyridinyl] N,N-diethylcarbamate (PubChem CID 134943200) has the molecular formula C15H22IN3O3 and a molecular weight of 419.26 g/mol. Its IUPAC name is [4-(diethylcarbamoyl)-2-iodo-3-pyridinyl] N,N-diethylcarbamate.
| Compound Name | [4-(diethylcarbamoyl)-2-iodo-3-pyridinyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 134943200 |
| Molecular Formula | C15H22IN3O3 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | [4-(diethylcarbamoyl)-2-iodo-3-pyridinyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1c(C(=O)N(CC)CC)ccnc1I |
| InChI | InChI=1S/C15H22IN3O3/c1-5-18(6-2)14(20)11-9-10-17-13(16)12(11)22-15(21)19(7-3)8-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | CDVXPQSYKXCXSA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|