About N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide
N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide (PubChem CID 105380283) has the molecular formula C12H14F2N2O
and a molecular weight of 240.25 g/mol. Its IUPAC name is N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide |
| PubChem CID | 105380283 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide |
| SMILES | C=C(C)CN(CC)C(=O)c1ccnc(F)c1F |
| InChI | InChI=1S/C12H14F2N2O/c1-4-16(7-8(2)3)12(17)9-5-6-15-11(14)10(9)13/h5-6H,2,4,7H2,1,3H3 |
| InChIKey | CRBNOLCTLOREEU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide?
The IUPAC name of N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide (CID 105380283) is N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide.
What is the SMILES notation for N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide?
The canonical SMILES for N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide is C=C(C)CN(CC)C(=O)c1ccnc(F)c1F.
What is the InChIKey of N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide?
The InChIKey is CRBNOLCTLOREEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N2O/c1-4-16(7-8(2)3)12(17)9-5-6-15-11(14)10(9)13/h5-6H,2,4,7H2,1,3H3.
What are the key properties of N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide?
N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide has a molecular weight of 240.25 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,3-difluoro-N-(2-methylprop-2-enyl)pyridine-4-carboxamide is sourced from PubChem (CID 105380283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).