C12H12F2N2O — CID 105380282
2,3-difluoro-N,N-bis(prop-2-enyl)pyridine-4-carboxamide (PubChem CID 105380282) has the molecular formula C12H12F2N2O and a molecular weight of 238.24 g/mol. Its IUPAC name is 2,3-difluoro-N,N-bis(prop-2-enyl)pyridine-4-carboxamide.
| Compound Name | 2,3-difluoro-N,N-bis(prop-2-enyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105380282 |
| Molecular Formula | C12H12F2N2O |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2,3-difluoro-N,N-bis(prop-2-enyl)pyridine-4-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccnc(F)c1F |
| InChI | InChI=1S/C12H12F2N2O/c1-3-7-16(8-4-2)12(17)9-5-6-15-11(14)10(9)13/h3-6H,1-2,7-8H2 |
| InChIKey | NXLLOHLJMOELCA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|