C14H16F2N2O — CID 105380891
N-cyclopentyl-2,3-difluoro-N-prop-2-enylpyridine-4-carboxamide (PubChem CID 105380891) has the molecular formula C14H16F2N2O and a molecular weight of 266.29 g/mol. Its IUPAC name is N-cyclopentyl-2,3-difluoro-N-prop-2-enylpyridine-4-carboxamide.
| Compound Name | N-cyclopentyl-2,3-difluoro-N-prop-2-enylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105380891 |
| Molecular Formula | C14H16F2N2O |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-cyclopentyl-2,3-difluoro-N-prop-2-enylpyridine-4-carboxamide |
| SMILES | C=CCN(C(=O)c1ccnc(F)c1F)C1CCCC1 |
| InChI | InChI=1S/C14H16F2N2O/c1-2-9-18(10-5-3-4-6-10)14(19)11-7-8-17-13(16)12(11)15/h2,7-8,10H,1,3-6,9H2 |
| InChIKey | BQYIRUMHLGKXRZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|