C12H14F2N2O — CID 105381168
N-(cyclobutylmethyl)-2,3-difluoro-N-methylpyridine-4-carboxamide (PubChem CID 105381168) has the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-2,3-difluoro-N-methylpyridine-4-carboxamide.
| Compound Name | N-(cyclobutylmethyl)-2,3-difluoro-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105381168 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N-(cyclobutylmethyl)-2,3-difluoro-N-methylpyridine-4-carboxamide |
| SMILES | CN(CC1CCC1)C(=O)c1ccnc(F)c1F |
| InChI | InChI=1S/C12H14F2N2O/c1-16(7-8-3-2-4-8)12(17)9-5-6-15-11(14)10(9)13/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | WRNSZKNUNHIJDH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|