C14H15F4NO — CID 79886002
N-(cyclobutylmethyl)-2-fluoro-N-methyl-3-(trifluoromethyl)benzamide (PubChem CID 79886002) has the molecular formula C14H15F4NO and a molecular weight of 289.27 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-2-fluoro-N-methyl-3-(trifluoromethyl)benzamide.
| Compound Name | N-(cyclobutylmethyl)-2-fluoro-N-methyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 79886002 |
| Molecular Formula | C14H15F4NO |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-(cyclobutylmethyl)-2-fluoro-N-methyl-3-(trifluoromethyl)benzamide |
| SMILES | CN(CC1CCC1)C(=O)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C14H15F4NO/c1-19(8-9-4-2-5-9)13(20)10-6-3-7-11(12(10)15)14(16,17)18/h3,6-7,9H,2,4-5,8H2,1H3 |
| InChIKey | DWXCRQQNKZTWJM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |