C13H18FN3O2 — CID 105386353
2-amino-3-fluoro-N-methyl-N-(oxan-3-ylmethyl)pyridine-4-carboxamide (PubChem CID 105386353) has the molecular formula C13H18FN3O2 and a molecular weight of 267.30 g/mol. Its IUPAC name is 2-amino-3-fluoro-N-methyl-N-(oxan-3-ylmethyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-3-fluoro-N-methyl-N-(oxan-3-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105386353 |
| Molecular Formula | C13H18FN3O2 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-amino-3-fluoro-N-methyl-N-(oxan-3-ylmethyl)pyridine-4-carboxamide |
| SMILES | CN(CC1CCCOC1)C(=O)c1ccnc(N)c1F |
| InChI | InChI=1S/C13H18FN3O2/c1-17(7-9-3-2-6-19-8-9)13(18)10-4-5-16-12(15)11(10)14/h4-5,9H,2-3,6-8H2,1H3,(H2,15,16) |
| InChIKey | BAVIQFGGOZNWLP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |