C15H23N3O2 — CID 81242094
4-(ethylamino)-N-methyl-N-(oxan-3-ylmethyl)pyridine-3-carboxamide (PubChem CID 81242094) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 4-(ethylamino)-N-methyl-N-(oxan-3-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 4-(ethylamino)-N-methyl-N-(oxan-3-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81242094 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 4-(ethylamino)-N-methyl-N-(oxan-3-ylmethyl)pyridine-3-carboxamide |
| SMILES | CCNc1ccncc1C(=O)N(C)CC1CCCOC1 |
| InChI | InChI=1S/C15H23N3O2/c1-3-17-14-6-7-16-9-13(14)15(19)18(2)10-12-5-4-8-20-11-12/h6-7,9,12H,3-5,8,10-11H2,1-2H3,(H,16,17) |
| InChIKey | QUDDWRZHVYXTHO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |