C14H21N3O2 — CID 81241215
4-amino-N,6-dimethyl-N-(oxan-3-ylmethyl)pyridine-3-carboxamide (PubChem CID 81241215) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-amino-N,6-dimethyl-N-(oxan-3-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 4-amino-N,6-dimethyl-N-(oxan-3-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81241215 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 4-amino-N,6-dimethyl-N-(oxan-3-ylmethyl)pyridine-3-carboxamide |
| SMILES | Cc1cc(N)c(C(=O)N(C)CC2CCCOC2)cn1 |
| InChI | InChI=1S/C14H21N3O2/c1-10-6-13(15)12(7-16-10)14(18)17(2)8-11-4-3-5-19-9-11/h6-7,11H,3-5,8-9H2,1-2H3,(H2,15,16) |
| InChIKey | GGLMGLAAXYEXCB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |