C11H13F2N3O2 — CID 105380365
N-[2-(dimethylamino)-2-oxoethyl]-2,3-difluoro-N-methylpyridine-4-carboxamide (PubChem CID 105380365) has the molecular formula C11H13F2N3O2 and a molecular weight of 257.24 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-2,3-difluoro-N-methylpyridine-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-2,3-difluoro-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105380365 |
| Molecular Formula | C11H13F2N3O2 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-2,3-difluoro-N-methylpyridine-4-carboxamide |
| SMILES | CN(C)C(=O)CN(C)C(=O)c1ccnc(F)c1F |
| InChI | InChI=1S/C11H13F2N3O2/c1-15(2)8(17)6-16(3)11(18)7-4-5-14-10(13)9(7)12/h4-5H,6H2,1-3H3 |
| InChIKey | TWMYJLWAPNVMSS-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|