C11H12F2N2O3 — CID 105381063
methyl 3-[(2,3-difluoropyridine-4-carbonyl)-methylamino]propanoate (PubChem CID 105381063) has the molecular formula C11H12F2N2O3 and a molecular weight of 258.22 g/mol. Its IUPAC name is methyl 3-[(2,3-difluoropyridine-4-carbonyl)-methylamino]propanoate.
| Compound Name | methyl 3-[(2,3-difluoropyridine-4-carbonyl)-methylamino]propanoate |
|---|---|
| PubChem CID | 105381063 |
| Molecular Formula | C11H12F2N2O3 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | methyl 3-[(2,3-difluoropyridine-4-carbonyl)-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)C(=O)c1ccnc(F)c1F |
| InChI | InChI=1S/C11H12F2N2O3/c1-15(6-4-8(16)18-2)11(17)7-3-5-14-10(13)9(7)12/h3,5H,4,6H2,1-2H3 |
| InChIKey | VUQJYEHXBULJPX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|