C11H10F2N4O — CID 105381264
2,3-difluoro-N-methyl-N-(1H-pyrazol-4-ylmethyl)pyridine-4-carboxamide (PubChem CID 105381264) has the molecular formula C11H10F2N4O and a molecular weight of 252.22 g/mol. Its IUPAC name is 2,3-difluoro-N-methyl-N-(1H-pyrazol-4-ylmethyl)pyridine-4-carboxamide.
| Compound Name | 2,3-difluoro-N-methyl-N-(1H-pyrazol-4-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105381264 |
| Molecular Formula | C11H10F2N4O |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2,3-difluoro-N-methyl-N-(1H-pyrazol-4-ylmethyl)pyridine-4-carboxamide |
| SMILES | CN(Cc1cn[nH]c1)C(=O)c1ccnc(F)c1F |
| InChI | InChI=1S/C11H10F2N4O/c1-17(6-7-4-15-16-5-7)11(18)8-2-3-14-10(13)9(8)12/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | JRCFWUBPFIFYDZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|