C10H10F4N2O2 — CID 107479235
N-(2,2-difluoroethyl)-2,3-difluoro-N-(2-hydroxyethyl)pyridine-4-carboxamide (PubChem CID 107479235) has the molecular formula C10H10F4N2O2 and a molecular weight of 266.19 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2,3-difluoro-N-(2-hydroxyethyl)pyridine-4-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-2,3-difluoro-N-(2-hydroxyethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 107479235 |
| Molecular Formula | C10H10F4N2O2 |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | N-(2,2-difluoroethyl)-2,3-difluoro-N-(2-hydroxyethyl)pyridine-4-carboxamide |
| SMILES | O=C(c1ccnc(F)c1F)N(CCO)CC(F)F |
| InChI | InChI=1S/C10H10F4N2O2/c11-7(12)5-16(3-4-17)10(18)6-1-2-15-9(14)8(6)13/h1-2,7,17H,3-5H2 |
| InChIKey | QSKLZJGLHNCTRW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|