C11H10Cl2F3NO2 — CID 107483219
2,4-dichloro-N-(2,2-difluoroethyl)-5-fluoro-N-(2-hydroxyethyl)benzamide (PubChem CID 107483219) has the molecular formula C11H10Cl2F3NO2 and a molecular weight of 316.11 g/mol. Its IUPAC name is 2,4-dichloro-N-(2,2-difluoroethyl)-5-fluoro-N-(2-hydroxyethyl)benzamide.
| Compound Name | 2,4-dichloro-N-(2,2-difluoroethyl)-5-fluoro-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 107483219 |
| Molecular Formula | C11H10Cl2F3NO2 |
| Molecular Weight | 316.11 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 2,4-dichloro-N-(2,2-difluoroethyl)-5-fluoro-N-(2-hydroxyethyl)benzamide |
| SMILES | O=C(c1cc(F)c(Cl)cc1Cl)N(CCO)CC(F)F |
| InChI | InChI=1S/C11H10Cl2F3NO2/c12-7-4-8(13)9(14)3-6(7)11(19)17(1-2-18)5-10(15)16/h3-4,10,18H,1-2,5H2 |
| InChIKey | LOPYEZHRFOVHPG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.11 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|