C11H13ClFNO3 — CID 61145588
5-chloro-2-fluoro-N,N-bis(2-hydroxyethyl)benzamide (PubChem CID 61145588) has the molecular formula C11H13ClFNO3 and a molecular weight of 261.68 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N,N-bis(2-hydroxyethyl)benzamide.
| Compound Name | 5-chloro-2-fluoro-N,N-bis(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 61145588 |
| Molecular Formula | C11H13ClFNO3 |
| Molecular Weight | 261.68 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 5-chloro-2-fluoro-N,N-bis(2-hydroxyethyl)benzamide |
| SMILES | O=C(c1cc(Cl)ccc1F)N(CCO)CCO |
| InChI | InChI=1S/C11H13ClFNO3/c12-8-1-2-10(13)9(7-8)11(17)14(3-5-15)4-6-16/h1-2,7,15-16H,3-6H2 |
| InChIKey | BADHIJKWHJJILY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.68 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |