C12H14ClF2NO2 — CID 82771632
4-chloro-2,5-difluoro-N-(2-hydroxyethyl)-N-propylbenzamide (PubChem CID 82771632) has the molecular formula C12H14ClF2NO2 and a molecular weight of 277.70 g/mol. Its IUPAC name is 4-chloro-2,5-difluoro-N-(2-hydroxyethyl)-N-propylbenzamide.
| Compound Name | 4-chloro-2,5-difluoro-N-(2-hydroxyethyl)-N-propylbenzamide |
|---|---|
| PubChem CID | 82771632 |
| Molecular Formula | C12H14ClF2NO2 |
| Molecular Weight | 277.70 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-chloro-2,5-difluoro-N-(2-hydroxyethyl)-N-propylbenzamide |
| SMILES | CCCN(CCO)C(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C12H14ClF2NO2/c1-2-3-16(4-5-17)12(18)8-6-11(15)9(13)7-10(8)14/h6-7,17H,2-5H2,1H3 |
| InChIKey | LPHWNWCXGKQOCW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.70 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|