C12H14F3NO3 — CID 61425303
2,4,5-trifluoro-3-hydroxy-N-(2-hydroxyethyl)-N-propylbenzamide (PubChem CID 61425303) has the molecular formula C12H14F3NO3 and a molecular weight of 277.24 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-hydroxy-N-(2-hydroxyethyl)-N-propylbenzamide.
| Compound Name | 2,4,5-trifluoro-3-hydroxy-N-(2-hydroxyethyl)-N-propylbenzamide |
|---|---|
| PubChem CID | 61425303 |
| Molecular Formula | C12H14F3NO3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2,4,5-trifluoro-3-hydroxy-N-(2-hydroxyethyl)-N-propylbenzamide |
| SMILES | CCCN(CCO)C(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C12H14F3NO3/c1-2-3-16(4-5-17)12(19)7-6-8(13)10(15)11(18)9(7)14/h6,17-18H,2-5H2,1H3 |
| InChIKey | NUJRGJHKBZBJAD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|