C13H14F3NO4 — CID 61011714
ethyl 2-[ethyl-(2,4,5-trifluoro-3-hydroxybenzoyl)amino]acetate (PubChem CID 61011714) has the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. Its IUPAC name is ethyl 2-[ethyl-(2,4,5-trifluoro-3-hydroxybenzoyl)amino]acetate.
| Compound Name | ethyl 2-[ethyl-(2,4,5-trifluoro-3-hydroxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 61011714 |
| Molecular Formula | C13H14F3NO4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | ethyl 2-[ethyl-(2,4,5-trifluoro-3-hydroxybenzoyl)amino]acetate |
| SMILES | CCOC(=O)CN(CC)C(=O)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C13H14F3NO4/c1-3-17(6-9(18)21-4-2)13(20)7-5-8(14)11(16)12(19)10(7)15/h5,19H,3-4,6H2,1-2H3 |
| InChIKey | QZSOHMSMNCZFQL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|