C14H14F5NO4 — CID 170570488
ethyl 2-[ethyl-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]amino]acetate (PubChem CID 170570488) has the molecular formula C14H14F5NO4 and a molecular weight of 355.26 g/mol. Its IUPAC name is ethyl 2-[ethyl-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]amino]acetate.
| Compound Name | ethyl 2-[ethyl-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]amino]acetate |
|---|---|
| PubChem CID | 170570488 |
| Molecular Formula | C14H14F5NO4 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | ethyl 2-[ethyl-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]amino]acetate |
| SMILES | CCOC(=O)CN(CC)C(=O)COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H14F5NO4/c1-3-20(5-8(22)23-4-2)7(21)6-24-14-12(18)10(16)9(15)11(17)13(14)19/h3-6H2,1-2H3 |
| InChIKey | SIIBJXYKWWDUDS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|