C9H7F3O3 — CID 46311393
ethyl 2,3,5-trifluoro-4-hydroxybenzoate (PubChem CID 46311393) has the molecular formula C9H7F3O3 and a molecular weight of 220.15 g/mol. Its IUPAC name is ethyl 2,3,5-trifluoro-4-hydroxybenzoate.
| Compound Name | ethyl 2,3,5-trifluoro-4-hydroxybenzoate |
|---|---|
| PubChem CID | 46311393 |
| Molecular Formula | C9H7F3O3 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | ethyl 2,3,5-trifluoro-4-hydroxybenzoate |
| SMILES | CCOC(=O)c1cc(F)c(O)c(F)c1F |
| InChI | InChI=1S/C9H7F3O3/c1-2-15-9(14)4-3-5(10)8(13)7(12)6(4)11/h3,13H,2H2,1H3 |
| InChIKey | VDIUATOCPYUEQQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|