C13H13F3O4 — CID 22666446
ethyl 4-(2-ethoxy-2-oxoethyl)-2,3,5-trifluorobenzoate (PubChem CID 22666446) has the molecular formula C13H13F3O4 and a molecular weight of 290.24 g/mol. Its IUPAC name is ethyl 4-(2-ethoxy-2-oxoethyl)-2,3,5-trifluorobenzoate.
| Compound Name | ethyl 4-(2-ethoxy-2-oxoethyl)-2,3,5-trifluorobenzoate |
|---|---|
| PubChem CID | 22666446 |
| Molecular Formula | C13H13F3O4 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | ethyl 4-(2-ethoxy-2-oxoethyl)-2,3,5-trifluorobenzoate |
| SMILES | CCOC(=O)Cc1c(F)cc(C(=O)OCC)c(F)c1F |
| InChI | InChI=1S/C13H13F3O4/c1-3-19-10(17)6-7-9(14)5-8(12(16)11(7)15)13(18)20-4-2/h5H,3-4,6H2,1-2H3 |
| InChIKey | HVNZXVCPORLSSE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|