C9H6Cl3FO2 — CID 81445840
ethyl 2,3,4-trichloro-5-fluorobenzoate (PubChem CID 81445840) has the molecular formula C9H6Cl3FO2 and a molecular weight of 271.50 g/mol. Its IUPAC name is ethyl 2,3,4-trichloro-5-fluorobenzoate.
| Compound Name | ethyl 2,3,4-trichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 81445840 |
| Molecular Formula | C9H6Cl3FO2 |
| Molecular Weight | 271.50 g/mol |
| Exact Mass | 269.94 |
| IUPAC Name | ethyl 2,3,4-trichloro-5-fluorobenzoate |
| SMILES | CCOC(=O)c1cc(F)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C9H6Cl3FO2/c1-2-15-9(14)4-3-5(13)7(11)8(12)6(4)10/h3H,2H2,1H3 |
| InChIKey | QPRPANIHWLHTAK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|