C12H13Cl3FNO3 — CID 168638936
ethyl 2,4-dichloro-3-[(3-chloro-2-hydroxypropyl)amino]-5-fluorobenzoate (PubChem CID 168638936) has the molecular formula C12H13Cl3FNO3 and a molecular weight of 344.60 g/mol. Its IUPAC name is ethyl 2,4-dichloro-3-[(3-chloro-2-hydroxypropyl)amino]-5-fluorobenzoate.
| Compound Name | ethyl 2,4-dichloro-3-[(3-chloro-2-hydroxypropyl)amino]-5-fluorobenzoate |
|---|---|
| PubChem CID | 168638936 |
| Molecular Formula | C12H13Cl3FNO3 |
| Molecular Weight | 344.60 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | ethyl 2,4-dichloro-3-[(3-chloro-2-hydroxypropyl)amino]-5-fluorobenzoate |
| SMILES | CCOC(=O)c1cc(F)c(Cl)c(NCC(O)CCl)c1Cl |
| InChI | InChI=1S/C12H13Cl3FNO3/c1-2-20-12(19)7-3-8(16)10(15)11(9(7)14)17-5-6(18)4-13/h3,6,17-18H,2,4-5H2,1H3 |
| InChIKey | JFFQKCBENOSPKN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|