C15H21Cl2N3O5 — CID 168639486
ethyl N-[[5-chloro-2-[(3-chloro-2-hydroxypropyl)amino]-3-methoxy-6-methylbenzoyl]amino]carbamate (PubChem CID 168639486) has the molecular formula C15H21Cl2N3O5 and a molecular weight of 394.26 g/mol. Its IUPAC name is ethyl N-[[5-chloro-2-[(3-chloro-2-hydroxypropyl)amino]-3-methoxy-6-methylbenzoyl]amino]carbamate.
| Compound Name | ethyl N-[[5-chloro-2-[(3-chloro-2-hydroxypropyl)amino]-3-methoxy-6-methylbenzoyl]amino]carbamate |
|---|---|
| PubChem CID | 168639486 |
| Molecular Formula | C15H21Cl2N3O5 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | ethyl N-[[5-chloro-2-[(3-chloro-2-hydroxypropyl)amino]-3-methoxy-6-methylbenzoyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)c1c(C)c(Cl)cc(OC)c1NCC(O)CCl |
| InChI | InChI=1S/C15H21Cl2N3O5/c1-4-25-15(23)20-19-14(22)12-8(2)10(17)5-11(24-3)13(12)18-7-9(21)6-16/h5,9,18,21H,4,6-7H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | ZUQJCUGLXOVTNM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|