C10H11Br3ClNO — CID 168636697
1-chloro-3-(2,4,6-tribromo-3-methylanilino)propan-2-ol (PubChem CID 168636697) has the molecular formula C10H11Br3ClNO and a molecular weight of 436.37 g/mol. Its IUPAC name is 1-chloro-3-(2,4,6-tribromo-3-methylanilino)propan-2-ol.
| Compound Name | 1-chloro-3-(2,4,6-tribromo-3-methylanilino)propan-2-ol |
|---|---|
| PubChem CID | 168636697 |
| Molecular Formula | C10H11Br3ClNO |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 432.81 |
| IUPAC Name | 1-chloro-3-(2,4,6-tribromo-3-methylanilino)propan-2-ol |
| SMILES | Cc1c(Br)cc(Br)c(NCC(O)CCl)c1Br |
| InChI | InChI=1S/C10H11Br3ClNO/c1-5-7(11)2-8(12)10(9(5)13)15-4-6(16)3-14/h2,6,15-16H,3-4H2,1H3 |
| InChIKey | FOVMJZQJKRGVON-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|