C13H21ClN2O — CID 20748857
1-(4-amino-2,3,5,6-tetramethylanilino)-3-chloropropan-2-ol (PubChem CID 20748857) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 1-(4-amino-2,3,5,6-tetramethylanilino)-3-chloropropan-2-ol.
| Compound Name | 1-(4-amino-2,3,5,6-tetramethylanilino)-3-chloropropan-2-ol |
|---|---|
| PubChem CID | 20748857 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-(4-amino-2,3,5,6-tetramethylanilino)-3-chloropropan-2-ol |
| SMILES | Cc1c(C)c(NCC(O)CCl)c(C)c(C)c1N |
| InChI | InChI=1S/C13H21ClN2O/c1-7-9(3)13(16-6-11(17)5-14)10(4)8(2)12(7)15/h11,16-17H,5-6,15H2,1-4H3 |
| InChIKey | YDRHWBCXBXNOBJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|