C11H15Cl2NO3S — CID 168638776
1-chloro-3-(2-chloro-3-methyl-5-methylsulfonylanilino)propan-2-ol (PubChem CID 168638776) has the molecular formula C11H15Cl2NO3S and a molecular weight of 312.22 g/mol. Its IUPAC name is 1-chloro-3-(2-chloro-3-methyl-5-methylsulfonylanilino)propan-2-ol.
| Compound Name | 1-chloro-3-(2-chloro-3-methyl-5-methylsulfonylanilino)propan-2-ol |
|---|---|
| PubChem CID | 168638776 |
| Molecular Formula | C11H15Cl2NO3S |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 1-chloro-3-(2-chloro-3-methyl-5-methylsulfonylanilino)propan-2-ol |
| SMILES | Cc1cc(S(C)(=O)=O)cc(NCC(O)CCl)c1Cl |
| InChI | InChI=1S/C11H15Cl2NO3S/c1-7-3-9(18(2,16)17)4-10(11(7)13)14-6-8(15)5-12/h3-4,8,14-15H,5-6H2,1-2H3 |
| InChIKey | PWQMEOXGKFQFSP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|