C12H18ClNO3S — CID 168637485
1-chloro-3-(2,4-dimethyl-5-methylsulfonylanilino)propan-2-ol (PubChem CID 168637485) has the molecular formula C12H18ClNO3S and a molecular weight of 291.80 g/mol. Its IUPAC name is 1-chloro-3-(2,4-dimethyl-5-methylsulfonylanilino)propan-2-ol.
| Compound Name | 1-chloro-3-(2,4-dimethyl-5-methylsulfonylanilino)propan-2-ol |
|---|---|
| PubChem CID | 168637485 |
| Molecular Formula | C12H18ClNO3S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 1-chloro-3-(2,4-dimethyl-5-methylsulfonylanilino)propan-2-ol |
| SMILES | Cc1cc(C)c(S(C)(=O)=O)cc1NCC(O)CCl |
| InChI | InChI=1S/C12H18ClNO3S/c1-8-4-9(2)12(18(3,16)17)5-11(8)14-7-10(15)6-13/h4-5,10,14-15H,6-7H2,1-3H3 |
| InChIKey | LZDRBDUXQRCWHX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|