C12H15ClN2O — CID 168639832
5-[(3-chloro-2-hydroxypropyl)amino]-2,4-dimethylbenzonitrile (PubChem CID 168639832) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 5-[(3-chloro-2-hydroxypropyl)amino]-2,4-dimethylbenzonitrile.
| Compound Name | 5-[(3-chloro-2-hydroxypropyl)amino]-2,4-dimethylbenzonitrile |
|---|---|
| PubChem CID | 168639832 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 5-[(3-chloro-2-hydroxypropyl)amino]-2,4-dimethylbenzonitrile |
| SMILES | Cc1cc(C)c(NCC(O)CCl)cc1C#N |
| InChI | InChI=1S/C12H15ClN2O/c1-8-3-9(2)12(4-10(8)6-14)15-7-11(16)5-13/h3-4,11,15-16H,5,7H2,1-2H3 |
| InChIKey | NNZLCGSFCAJDGO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|