C12H16ClFN2O2 — CID 168638760
N-[2-[(3-chloro-2-hydroxypropyl)amino]-4-fluoro-6-methylphenyl]acetamide (PubChem CID 168638760) has the molecular formula C12H16ClFN2O2 and a molecular weight of 274.72 g/mol. Its IUPAC name is N-[2-[(3-chloro-2-hydroxypropyl)amino]-4-fluoro-6-methylphenyl]acetamide.
| Compound Name | N-[2-[(3-chloro-2-hydroxypropyl)amino]-4-fluoro-6-methylphenyl]acetamide |
|---|---|
| PubChem CID | 168638760 |
| Molecular Formula | C12H16ClFN2O2 |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-[2-[(3-chloro-2-hydroxypropyl)amino]-4-fluoro-6-methylphenyl]acetamide |
| SMILES | CC(=O)Nc1c(C)cc(F)cc1NCC(O)CCl |
| InChI | InChI=1S/C12H16ClFN2O2/c1-7-3-9(14)4-11(12(7)16-8(2)17)15-6-10(18)5-13/h3-4,10,15,18H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | BJIPQZYJRDHHDT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|