C10H12FNO — CID 126993830
N-(2-fluoro-4,6-dimethylphenyl)acetamide (PubChem CID 126993830) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is N-(2-fluoro-4,6-dimethylphenyl)acetamide.
| Compound Name | N-(2-fluoro-4,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126993830 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-(2-fluoro-4,6-dimethylphenyl)acetamide |
| SMILES | CC(=O)Nc1c(C)cc(C)cc1F |
| InChI | InChI=1S/C10H12FNO/c1-6-4-7(2)10(9(11)5-6)12-8(3)13/h4-5H,1-3H3,(H,12,13) |
| InChIKey | BDRIMGRHZLBPOH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |