C22H26N2O2 — CID 1091194
(E)-N,N'-bis(2,4,6-trimethylphenyl)but-2-enediamide (PubChem CID 1091194) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (E)-N,N'-bis(2,4,6-trimethylphenyl)but-2-enediamide.
| Compound Name | (E)-N,N'-bis(2,4,6-trimethylphenyl)but-2-enediamide |
|---|---|
| PubChem CID | 1091194 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (E)-N,N'-bis(2,4,6-trimethylphenyl)but-2-enediamide |
| SMILES | Cc1cc(C)c(NC(=O)/C=C/C(=O)Nc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C22H26N2O2/c1-13-9-15(3)21(16(4)10-13)23-19(25)7-8-20(26)24-22-17(5)11-14(2)12-18(22)6/h7-12H,1-6H3,(H,23,25)(H,24,26)/b8-7+ |
| InChIKey | LNYYXROMJCIPIV-BQYQJAHWSA-N |
| XLogP | 4.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|