C12H12ClNO3 — CID 1238732
4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid (PubChem CID 1238732) has the molecular formula C12H12ClNO3 and a molecular weight of 253.69 g/mol. Its IUPAC name is 4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid.
| Compound Name | 4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 1238732 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid |
| SMILES | Cc1cc(C)c(NC(=O)C=CC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C12H12ClNO3/c1-7-5-8(2)12(9(13)6-7)14-10(15)3-4-11(16)17/h3-6H,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | LYXCUCCJBOTLKF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|