4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid

C12H12ClNO3 — CID 1238732

IUPAC4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid
SMILESCc1cc(C)c(NC(=O)C=CC(=O)O)c(Cl)c1
InChIInChI=1S/C12H12ClNO3/c1-7-5-8(2)12(9(13)6-7)14-10(15)3-4-11(16)17/h3-6H,1-2H3,(H,14,15)(H,16,17)
InChIKeyLYXCUCCJBOTLKF-UHFFFAOYSA-N
MW253.69 g/mol
LogP2.54
Rot. Bonds3

About 4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid

4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid (PubChem CID 1238732) has the molecular formula C12H12ClNO3 and a molecular weight of 253.69 g/mol. Its IUPAC name is 4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid
PubChem CID1238732
Molecular FormulaC12H12ClNO3
Molecular Weight253.69 g/mol
Exact Mass253.05
IUPAC Name4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid
SMILESCc1cc(C)c(NC(=O)C=CC(=O)O)c(Cl)c1
InChIInChI=1S/C12H12ClNO3/c1-7-5-8(2)12(9(13)6-7)14-10(15)3-4-11(16)17/h3-6H,1-2H3,(H,14,15)(H,16,17)
InChIKeyLYXCUCCJBOTLKF-UHFFFAOYSA-N
XLogP2.54
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.69
LogP ≤ 52.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid?
The IUPAC name of 4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid (CID 1238732) is 4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid.
What is the SMILES notation for 4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid?
The canonical SMILES for 4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid is Cc1cc(C)c(NC(=O)C=CC(=O)O)c(Cl)c1.
What is the InChIKey of 4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid?
The InChIKey is LYXCUCCJBOTLKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNO3/c1-7-5-8(2)12(9(13)6-7)14-10(15)3-4-11(16)17/h3-6H,1-2H3,(H,14,15)(H,16,17).
What are the key properties of 4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid?
4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid has a molecular weight of 253.69 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloro-4,6-dimethylanilino)-4-oxobut-2-enoic acid is sourced from PubChem (CID 1238732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).