C19H20ClNO3 — CID 731582
N-(2-chloro-4,6-dimethylphenyl)-3-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 731582) has the molecular formula C19H20ClNO3 and a molecular weight of 345.83 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-3-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-3-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 731582 |
| Molecular Formula | C19H20ClNO3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)Nc2c(C)cc(C)cc2Cl)cc1OC |
| InChI | InChI=1S/C19H20ClNO3/c1-12-9-13(2)19(15(20)10-12)21-18(22)8-6-14-5-7-16(23-3)17(11-14)24-4/h5-11H,1-4H3,(H,21,22) |
| InChIKey | AFQBDAQCXZCGLM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|