C19H20ClNO — CID 18278830
(E)-N-(2-chloro-4,6-dimethylphenyl)-3-(4-ethylphenyl)prop-2-enamide (PubChem CID 18278830) has the molecular formula C19H20ClNO and a molecular weight of 313.83 g/mol. Its IUPAC name is (E)-N-(2-chloro-4,6-dimethylphenyl)-3-(4-ethylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-chloro-4,6-dimethylphenyl)-3-(4-ethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18278830 |
| Molecular Formula | C19H20ClNO |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (E)-N-(2-chloro-4,6-dimethylphenyl)-3-(4-ethylphenyl)prop-2-enamide |
| SMILES | CCc1ccc(/C=C/C(=O)Nc2c(C)cc(C)cc2Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO/c1-4-15-5-7-16(8-6-15)9-10-18(22)21-19-14(3)11-13(2)12-17(19)20/h5-12H,4H2,1-3H3,(H,21,22)/b10-9+ |
| InChIKey | JHKRMZPKRQSFQS-MDZDMXLPSA-N |
| XLogP | 5.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|