C18H17BrFNO — CID 8759989
(E)-3-(5-bromo-2-fluorophenyl)-N-(2,4,6-trimethylphenyl)prop-2-enamide (PubChem CID 8759989) has the molecular formula C18H17BrFNO and a molecular weight of 362.24 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-N-(2,4,6-trimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-N-(2,4,6-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8759989 |
| Molecular Formula | C18H17BrFNO |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-N-(2,4,6-trimethylphenyl)prop-2-enamide |
| SMILES | Cc1cc(C)c(NC(=O)/C=C/c2cc(Br)ccc2F)c(C)c1 |
| InChI | InChI=1S/C18H17BrFNO/c1-11-8-12(2)18(13(3)9-11)21-17(22)7-4-14-10-15(19)5-6-16(14)20/h4-10H,1-3H3,(H,21,22)/b7-4+ |
| InChIKey | LVAUMGACQKQQRS-QPJJXVBHSA-N |
| XLogP | 5.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|