C18H17BrFNO — CID 7860851
(E)-3-(5-bromo-2-fluorophenyl)-N-[(1S)-1-(2-methylphenyl)ethyl]prop-2-enamide (PubChem CID 7860851) has the molecular formula C18H17BrFNO and a molecular weight of 362.24 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-N-[(1S)-1-(2-methylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[(1S)-1-(2-methylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 7860851 |
| Molecular Formula | C18H17BrFNO |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[(1S)-1-(2-methylphenyl)ethyl]prop-2-enamide |
| SMILES | Cc1ccccc1[C@H](C)NC(=O)/C=C/c1cc(Br)ccc1F |
| InChI | InChI=1S/C18H17BrFNO/c1-12-5-3-4-6-16(12)13(2)21-18(22)10-7-14-11-15(19)8-9-17(14)20/h3-11,13H,1-2H3,(H,21,22)/b10-7+/t13-/m0/s1 |
| InChIKey | GQYYVNQFBRRAEY-RSPDNQDQSA-N |
| XLogP | 4.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|