C22H21NO — CID 5178128
3-naphthalen-1-yl-N-(2,4,6-trimethylphenyl)prop-2-enamide (PubChem CID 5178128) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-naphthalen-1-yl-N-(2,4,6-trimethylphenyl)prop-2-enamide.
| Compound Name | 3-naphthalen-1-yl-N-(2,4,6-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5178128 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-naphthalen-1-yl-N-(2,4,6-trimethylphenyl)prop-2-enamide |
| SMILES | Cc1cc(C)c(NC(=O)C=Cc2cccc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C22H21NO/c1-15-13-16(2)22(17(3)14-15)23-21(24)12-11-19-9-6-8-18-7-4-5-10-20(18)19/h4-14H,1-3H3,(H,23,24) |
| InChIKey | OCKBXEZIHHBZSN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|