C21H20N2O3S — CID 55506917
(E)-N-(2,3-dimethyl-5-sulfamoylphenyl)-3-naphthalen-1-ylprop-2-enamide (PubChem CID 55506917) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is (E)-N-(2,3-dimethyl-5-sulfamoylphenyl)-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | (E)-N-(2,3-dimethyl-5-sulfamoylphenyl)-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 55506917 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (E)-N-(2,3-dimethyl-5-sulfamoylphenyl)-3-naphthalen-1-ylprop-2-enamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(NC(=O)/C=C/c2cccc3ccccc23)c1C |
| InChI | InChI=1S/C21H20N2O3S/c1-14-12-18(27(22,25)26)13-20(15(14)2)23-21(24)11-10-17-8-5-7-16-6-3-4-9-19(16)17/h3-13H,1-2H3,(H,23,24)(H2,22,25,26)/b11-10+ |
| InChIKey | VMIRENUTYXQNDR-ZHACJKMWSA-N |
| XLogP | 3.76 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|