C19H22N2O5S — CID 9141397
(E)-3-(2,4-dimethoxyphenyl)-N-(2,3-dimethyl-5-sulfamoylphenyl)prop-2-enamide (PubChem CID 9141397) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is (E)-3-(2,4-dimethoxyphenyl)-N-(2,3-dimethyl-5-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethoxyphenyl)-N-(2,3-dimethyl-5-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9141397 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (E)-3-(2,4-dimethoxyphenyl)-N-(2,3-dimethyl-5-sulfamoylphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2cc(S(N)(=O)=O)cc(C)c2C)c(OC)c1 |
| InChI | InChI=1S/C19H22N2O5S/c1-12-9-16(27(20,23)24)11-17(13(12)2)21-19(22)8-6-14-5-7-15(25-3)10-18(14)26-4/h5-11H,1-4H3,(H,21,22)(H2,20,23,24)/b8-6+ |
| InChIKey | VQYFNKADHINCRW-SOFGYWHQSA-N |
| XLogP | 2.62 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|