C17H20N2O5S — CID 9141653
N-(2,3-dimethyl-5-sulfamoylphenyl)-2,5-dimethoxybenzamide (PubChem CID 9141653) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is N-(2,3-dimethyl-5-sulfamoylphenyl)-2,5-dimethoxybenzamide.
| Compound Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 9141653 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-(2,3-dimethyl-5-sulfamoylphenyl)-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)Nc2cc(S(N)(=O)=O)cc(C)c2C)c1 |
| InChI | InChI=1S/C17H20N2O5S/c1-10-7-13(25(18,21)22)9-15(11(10)2)19-17(20)14-8-12(23-3)5-6-16(14)24-4/h5-9H,1-4H3,(H,19,20)(H2,18,21,22) |
| InChIKey | WMKBINCQQJFMED-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |