C20H23N3O3S — CID 7923434
1-[[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]-3-(2,3-dimethylphenyl)thiourea (PubChem CID 7923434) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-[[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]-3-(2,3-dimethylphenyl)thiourea.
| Compound Name | 1-[[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]-3-(2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 7923434 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-[[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]-3-(2,3-dimethylphenyl)thiourea |
| SMILES | COc1ccc(/C=C/C(=O)NNC(=S)Nc2cccc(C)c2C)c(OC)c1 |
| InChI | InChI=1S/C20H23N3O3S/c1-13-6-5-7-17(14(13)2)21-20(27)23-22-19(24)11-9-15-8-10-16(25-3)12-18(15)26-4/h5-12H,1-4H3,(H,22,24)(H2,21,23,27)/b11-9+ |
| InChIKey | IUDXIYSREQMFLX-PKNBQFBNSA-N |
| XLogP | 3.35 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|