C20H16ClNO — CID 92949912
(Z)-N-(3-chloro-4-methylphenyl)-3-naphthalen-1-ylprop-2-enamide (PubChem CID 92949912) has the molecular formula C20H16ClNO and a molecular weight of 321.81 g/mol. Its IUPAC name is (Z)-N-(3-chloro-4-methylphenyl)-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | (Z)-N-(3-chloro-4-methylphenyl)-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 92949912 |
| Molecular Formula | C20H16ClNO |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | (Z)-N-(3-chloro-4-methylphenyl)-3-naphthalen-1-ylprop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C=C\c2cccc3ccccc23)cc1Cl |
| InChI | InChI=1S/C20H16ClNO/c1-14-9-11-17(13-19(14)21)22-20(23)12-10-16-7-4-6-15-5-2-3-8-18(15)16/h2-13H,1H3,(H,22,23)/b12-10- |
| InChIKey | PUHWMTZYAFMKTQ-BENRWUELSA-N |
| XLogP | 5.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|