C27H24N2O3S — CID 6128957
(E)-N-[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]-3-naphthalen-1-ylprop-2-enamide (PubChem CID 6128957) has the molecular formula C27H24N2O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is (E)-N-[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | (E)-N-[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 6128957 |
| Molecular Formula | C27H24N2O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | (E)-N-[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]-3-naphthalen-1-ylprop-2-enamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2ccc(NC(=O)/C=C/c3cccc4ccccc34)cc2)c1 |
| InChI | InChI=1S/C27H24N2O3S/c1-19-16-20(2)18-24(17-19)29-33(31,32)25-13-11-23(12-14-25)28-27(30)15-10-22-8-5-7-21-6-3-4-9-26(21)22/h3-18,29H,1-2H3,(H,28,30)/b15-10+ |
| InChIKey | XJMSTCNLWNBCEX-XNTDXEJSSA-N |
| XLogP | 5.91 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|