C22H20N2O3S — CID 4929850
3-naphthalen-1-yl-N-[4-(prop-2-enylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 4929850) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 3-naphthalen-1-yl-N-[4-(prop-2-enylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | 3-naphthalen-1-yl-N-[4-(prop-2-enylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4929850 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 3-naphthalen-1-yl-N-[4-(prop-2-enylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(NC(=O)C=Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H20N2O3S/c1-2-16-23-28(26,27)20-13-11-19(12-14-20)24-22(25)15-10-18-8-5-7-17-6-3-4-9-21(17)18/h2-15,23H,1,16H2,(H,24,25) |
| InChIKey | LSSUTVONDNDSKS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|