C25H20N2O3S — CID 5157349
3-naphthalen-1-yl-N-[4-(phenylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 5157349) has the molecular formula C25H20N2O3S and a molecular weight of 428.51 g/mol. Its IUPAC name is 3-naphthalen-1-yl-N-[4-(phenylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | 3-naphthalen-1-yl-N-[4-(phenylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 5157349 |
| Molecular Formula | C25H20N2O3S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 3-naphthalen-1-yl-N-[4-(phenylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc2ccccc12)Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N2O3S/c28-25(18-13-20-9-6-8-19-7-4-5-12-24(19)20)26-21-14-16-23(17-15-21)31(29,30)27-22-10-2-1-3-11-22/h1-18,27H,(H,26,28) |
| InChIKey | URTSDPADVNWADC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|