C26H22N2O3S — CID 4928932
N-[4-(benzylsulfamoyl)phenyl]-3-naphthalen-1-ylprop-2-enamide (PubChem CID 4928932) has the molecular formula C26H22N2O3S and a molecular weight of 442.54 g/mol. Its IUPAC name is N-[4-(benzylsulfamoyl)phenyl]-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | N-[4-(benzylsulfamoyl)phenyl]-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 4928932 |
| Molecular Formula | C26H22N2O3S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | N-[4-(benzylsulfamoyl)phenyl]-3-naphthalen-1-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccc2ccccc12)Nc1ccc(S(=O)(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H22N2O3S/c29-26(18-13-22-11-6-10-21-9-4-5-12-25(21)22)28-23-14-16-24(17-15-23)32(30,31)27-19-20-7-2-1-3-8-20/h1-18,27H,19H2,(H,28,29) |
| InChIKey | JBEQMMUKJWTIIU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|