C23H22N2O3S — CID 98910520
(E)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-naphthalen-1-ylprop-2-enamide (PubChem CID 98910520) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is (E)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | (E)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 98910520 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (E)-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-naphthalen-1-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccc2ccccc12)NCc1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C23H22N2O3S/c26-23(15-10-19-6-3-5-18-4-1-2-7-22(18)19)24-16-17-8-13-21(14-9-17)29(27,28)25-20-11-12-20/h1-10,13-15,20,25H,11-12,16H2,(H,24,26)/b15-10+ |
| InChIKey | HVQHKPCAZQWNQQ-XNTDXEJSSA-N |
| XLogP | 3.61 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|